C12H21N3O — CID 145225486
4,6-dimethyl-6,7,8,9-tetrahydropyrazolo[1,5-a][1,3]diazocin-5-one;ethane (PubChem CID 145225486) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4,6-dimethyl-6,7,8,9-tetrahydropyrazolo[1,5-a][1,3]diazocin-5-one;ethane.
| Compound Name | 4,6-dimethyl-6,7,8,9-tetrahydropyrazolo[1,5-a][1,3]diazocin-5-one;ethane |
|---|---|
| PubChem CID | 145225486 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4,6-dimethyl-6,7,8,9-tetrahydropyrazolo[1,5-a][1,3]diazocin-5-one;ethane |
| SMILES | CC.CC1CCCn2nccc2N(C)C1=O |
| InChI | InChI=1S/C10H15N3O.C2H6/c1-8-4-3-7-13-9(5-6-11-13)12(2)10(8)14;1-2/h5-6,8H,3-4,7H2,1-2H3;1-2H3 |
| InChIKey | RJTSLZSQWUXSFN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |