C30H39N9OS — CID 145226267
8-[1-(3-ethyl-1-ethylsulfanylazetidin-3-yl)pyrazol-4-yl]-N-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine;formamide (PubChem CID 145226267) has the molecular formula C30H39N9OS and a molecular weight of 573.77 g/mol. Its IUPAC name is 8-[1-(3-ethyl-1-ethylsulfanylazetidin-3-yl)pyrazol-4-yl]-N-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine;formamide.
| Compound Name | 8-[1-(3-ethyl-1-ethylsulfanylazetidin-3-yl)pyrazol-4-yl]-N-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine;formamide |
|---|---|
| PubChem CID | 145226267 |
| Molecular Formula | C30H39N9OS |
| Molecular Weight | 573.77 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | 8-[1-(3-ethyl-1-ethylsulfanylazetidin-3-yl)pyrazol-4-yl]-N-[3-(4-methylpiperazin-1-yl)phenyl]quinazolin-2-amine;formamide |
| SMILES | CCSN1CC(CC)(n2cc(-c3cccc4cnc(Nc5cccc(N6CCN(C)CC6)c5)nc34)cn2)C1.NC=O |
| InChI | InChI=1S/C29H36N8S.CH3NO/c1-4-29(20-36(21-29)38-5-2)37-19-23(18-31-37)26-11-6-8-22-17-30-28(33-27(22)26)32-24-9-7-10-25(16-24)35-14-12-34(3)13-15-35;2-1-3/h6-11,16-19H,4-5,12-15,20-21H2,1-3H3,(H,30,32,33);1H,(H2,2,3) |
| InChIKey | CLSXIJBYOCMNPE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|