C25H29IN7S- — CID 152989383
CID 152989383 (PubChem CID 152989383) has the molecular formula C25H29IN7S- and a molecular weight of 586.53 g/mol.
| Compound Name | CID 152989383 |
|---|---|
| PubChem CID | 152989383 |
| Molecular Formula | C25H29IN7S- |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | — |
| SMILES | CN1CCN(c2cccc(Nc3ncc4ccc5sc(CN6CCN[I-]C6)cc5c4n3)c2)CC1 |
| InChI | InChI=1S/C25H29IN7S/c1-31-9-11-33(12-10-31)20-4-2-3-19(13-20)29-25-27-15-18-5-6-23-22(24(18)30-25)14-21(34-23)16-32-8-7-28-26-17-32/h2-6,13-15,28H,7-12,16-17H2,1H3,(H,27,29,30)/q-1 |
| InChIKey | NRJSIMQHTYIFPI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|