C14H17F3N6 — CID 145230252
N-amino-N'-[1-[7-(trifluoromethyl)imidazo[1,5-a]pyridin-5-yl]piperidin-4-yl]methanimidamide (PubChem CID 145230252) has the molecular formula C14H17F3N6 and a molecular weight of 326.33 g/mol. Its IUPAC name is N-amino-N'-[1-[7-(trifluoromethyl)imidazo[1,5-a]pyridin-5-yl]piperidin-4-yl]methanimidamide.
| Compound Name | N-amino-N'-[1-[7-(trifluoromethyl)imidazo[1,5-a]pyridin-5-yl]piperidin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 145230252 |
| Molecular Formula | C14H17F3N6 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-amino-N'-[1-[7-(trifluoromethyl)imidazo[1,5-a]pyridin-5-yl]piperidin-4-yl]methanimidamide |
| SMILES | NN/C=N/C1CCN(c2cc(C(F)(F)F)cc3cncn23)CC1 |
| InChI | InChI=1S/C14H17F3N6/c15-14(16,17)10-5-12-7-19-9-23(12)13(6-10)22-3-1-11(2-4-22)20-8-21-18/h5-9,11H,1-4,18H2,(H,20,21) |
| InChIKey | MURMLZFVUKKOOK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|