C22H23N3OS2 — CID 145231975
2-(4-ethylsulfanylphenyl)-N-[4-[1-(1H-pyrazol-4-ylsulfanyl)cyclopropyl]phenyl]acetamide (PubChem CID 145231975) has the molecular formula C22H23N3OS2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-N-[4-[1-(1H-pyrazol-4-ylsulfanyl)cyclopropyl]phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfanylphenyl)-N-[4-[1-(1H-pyrazol-4-ylsulfanyl)cyclopropyl]phenyl]acetamide |
|---|---|
| PubChem CID | 145231975 |
| Molecular Formula | C22H23N3OS2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-N-[4-[1-(1H-pyrazol-4-ylsulfanyl)cyclopropyl]phenyl]acetamide |
| SMILES | CCSc1ccc(CC(=O)Nc2ccc(C3(Sc4cn[nH]c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3OS2/c1-2-27-19-9-3-16(4-10-19)13-21(26)25-18-7-5-17(6-8-18)22(11-12-22)28-20-14-23-24-15-20/h3-10,14-15H,2,11-13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | RGRDWVWMRDZBCQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |