C28H41N5O4S — CID 145233504
ethane;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]acetamide;4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 145233504) has the molecular formula C28H41N5O4S and a molecular weight of 543.73 g/mol. Its IUPAC name is ethane;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]acetamide;4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | ethane;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]acetamide;4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 145233504 |
| Molecular Formula | C28H41N5O4S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | ethane;N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]acetamide;4,5,13-trimethyl-7-(4-methylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CC.CC(=O)NCCOCCOCCO.Cc1ccc(C2=NCc3nnc(C)n3-c3sc(C)c(C)c32)cc1 |
| InChI | InChI=1S/C18H18N4S.C8H17NO4.C2H6/c1-10-5-7-14(8-6-10)17-16-11(2)12(3)23-18(16)22-13(4)20-21-15(22)9-19-17;1-8(11)9-2-4-12-6-7-13-5-3-10;1-2/h5-8H,9H2,1-4H3;10H,2-7H2,1H3,(H,9,11);1-2H3 |
| InChIKey | QLPBASMDGQWXFK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|