C30H43ClN6O2S2 — CID 171071628
7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;N-[1-[2-methyl-4-(propylamino)butan-2-yl]oxy-2-sulfanylpropan-2-yl]acetamide (PubChem CID 171071628) has the molecular formula C30H43ClN6O2S2 and a molecular weight of 619.30 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;N-[1-[2-methyl-4-(propylamino)butan-2-yl]oxy-2-sulfanylpropan-2-yl]acetamide.
| Compound Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;N-[1-[2-methyl-4-(propylamino)butan-2-yl]oxy-2-sulfanylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 171071628 |
| Molecular Formula | C30H43ClN6O2S2 |
| Molecular Weight | 619.30 g/mol |
| Exact Mass | 618.26 |
| IUPAC Name | 7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene;N-[1-[2-methyl-4-(propylamino)butan-2-yl]oxy-2-sulfanylpropan-2-yl]acetamide |
| SMILES | CCCNCCC(C)(C)OCC(C)(S)NC(C)=O.Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=NCc1nnc(C)n1-2 |
| InChI | InChI=1S/C17H15ClN4S.C13H28N2O2S/c1-9-10(2)23-17-15(9)16(12-4-6-13(18)7-5-12)19-8-14-21-20-11(3)22(14)17;1-6-8-14-9-7-12(3,4)17-10-13(5,18)15-11(2)16/h4-7H,8H2,1-3H3;14,18H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | ZHIBYTACADAQPK-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.30 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|