C26H34N4O2S — CID 144853771
tert-butyl acetate;4,5,13-trimethyl-7-(4-propan-2-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 144853771) has the molecular formula C26H34N4O2S and a molecular weight of 466.65 g/mol. Its IUPAC name is tert-butyl acetate;4,5,13-trimethyl-7-(4-propan-2-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | tert-butyl acetate;4,5,13-trimethyl-7-(4-propan-2-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 144853771 |
| Molecular Formula | C26H34N4O2S |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | tert-butyl acetate;4,5,13-trimethyl-7-(4-propan-2-ylphenyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CC(=O)OC(C)(C)C.Cc1sc2c(c1C)C(c1ccc(C(C)C)cc1)=NCc1nnc(C)n1-2 |
| InChI | InChI=1S/C20H22N4S.C6H12O2/c1-11(2)15-6-8-16(9-7-15)19-18-12(3)13(4)25-20(18)24-14(5)22-23-17(24)10-21-19;1-5(7)8-6(2,3)4/h6-9,11H,10H2,1-5H3;1-4H3 |
| InChIKey | VPRXYZLWEBEMHJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |