C23H21F5O4 — CID 145233819
acetylene;2-[2,4-difluoro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]phenoxy]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 145233819) has the molecular formula C23H21F5O4 and a molecular weight of 456.41 g/mol. Its IUPAC name is acetylene;2-[2,4-difluoro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]phenoxy]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | acetylene;2-[2,4-difluoro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]phenoxy]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 145233819 |
| Molecular Formula | C23H21F5O4 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | acetylene;2-[2,4-difluoro-6-[(E)-2-[2-(trifluoromethyl)phenyl]ethenyl]phenoxy]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | C#C.OCC1CC(O)CC(Oc2c(F)cc(F)cc2/C=C/c2ccccc2C(F)(F)F)O1 |
| InChI | InChI=1S/C21H19F5O4.C2H2/c22-14-7-13(6-5-12-3-1-2-4-17(12)21(24,25)26)20(18(23)8-14)30-19-10-15(28)9-16(11-27)29-19;1-2/h1-8,15-16,19,27-28H,9-11H2;1-2H/b6-5+; |
| InChIKey | UQEBMCFPKLWIHG-IPZCTEOASA-N |
| XLogP | 4.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|