C20H20F2O6 — CID 126503424
(2S,3R,4S,5S,6R)-2-[2,4-difluoro-6-[(E)-2-phenylethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 126503424) has the molecular formula C20H20F2O6 and a molecular weight of 394.37 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[2,4-difluoro-6-[(E)-2-phenylethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[2,4-difluoro-6-[(E)-2-phenylethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126503424 |
| Molecular Formula | C20H20F2O6 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2,4-difluoro-6-[(E)-2-phenylethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2c(F)cc(F)cc2/C=C/c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20F2O6/c21-13-8-12(7-6-11-4-2-1-3-5-11)19(14(22)9-13)28-20-18(26)17(25)16(24)15(10-23)27-20/h1-9,15-18,20,23-26H,10H2/b7-6+/t15-,16-,17+,18-,20+/m1/s1 |
| InChIKey | SGZHADUUOHDYIO-RFZNYMOXSA-N |
| XLogP | 1.31 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|