C22H25FO8 — CID 126503465
(3R,4S,5S,6R)-2-[2-[(E)-2-(3-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 126503465) has the molecular formula C22H25FO8 and a molecular weight of 436.43 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[2-[(E)-2-(3-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[2-[(E)-2-(3-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 126503465 |
| Molecular Formula | C22H25FO8 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (3R,4S,5S,6R)-2-[2-[(E)-2-(3-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1cc(/C=C/c2cccc(F)c2)c(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C22H25FO8/c1-28-15-9-13(7-6-12-4-3-5-14(23)8-12)21(16(10-15)29-2)31-22-20(27)19(26)18(25)17(11-24)30-22/h3-10,17-20,22,24-27H,11H2,1-2H3/b7-6+/t17-,18-,19+,20-,22?/m1/s1 |
| InChIKey | PGIDTPSSLCLPNG-GUAZPRTISA-N |
| XLogP | 1.19 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|