C23H25NO8 — CID 126503441
2-[(E)-2-[3,5-dimethoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethenyl]benzonitrile (PubChem CID 126503441) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-[(E)-2-[3,5-dimethoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethenyl]benzonitrile.
| Compound Name | 2-[(E)-2-[3,5-dimethoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 126503441 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-[(E)-2-[3,5-dimethoxy-2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]ethenyl]benzonitrile |
| SMILES | COc1cc(/C=C/c2ccccc2C#N)c(OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C23H25NO8/c1-29-16-9-14(8-7-13-5-3-4-6-15(13)11-24)22(17(10-16)30-2)32-23-21(28)20(27)19(26)18(12-25)31-23/h3-10,18-21,23,25-28H,12H2,1-2H3/b8-7+/t18-,19-,20+,21-,23?/m1/s1 |
| InChIKey | MOPDXKRIKNYPIM-YTQPJFAXSA-N |
| XLogP | 0.92 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|