C23H25NO7 — CID 126545234
4-[(E)-2-[2-[(2S,3R,4S,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]ethenyl]benzonitrile (PubChem CID 126545234) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 4-[(E)-2-[2-[(2S,3R,4S,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-[2-[(2S,3R,4S,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 126545234 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[(E)-2-[2-[(2S,3R,4S,6S)-3,4-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,5-dimethoxyphenyl]ethenyl]benzonitrile |
| SMILES | COc1cc(/C=C/c2ccc(C#N)cc2)c(O[C@@H]2O[C@H](CO)C[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C23H25NO7/c1-28-17-9-16(8-7-14-3-5-15(12-24)6-4-14)22(20(11-17)29-2)31-23-21(27)19(26)10-18(13-25)30-23/h3-9,11,18-19,21,23,25-27H,10,13H2,1-2H3/b8-7+/t18-,19-,21+,23-/m0/s1 |
| InChIKey | UPPSXMCALFXKMD-CJIYRYKJSA-N |
| XLogP | 1.95 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|