C31H35FO12 — CID 145233829
[(2R,3R,4S,5R,6S)-3,5-diacetyloxy-2-[(1R)-1-acetyloxyethyl]-6-[2-[(E)-2-(4-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]oxan-4-yl] acetate (PubChem CID 145233829) has the molecular formula C31H35FO12 and a molecular weight of 618.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-2-[(1R)-1-acetyloxyethyl]-6-[2-[(E)-2-(4-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-2-[(1R)-1-acetyloxyethyl]-6-[2-[(E)-2-(4-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 145233829 |
| Molecular Formula | C31H35FO12 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetyloxy-2-[(1R)-1-acetyloxyethyl]-6-[2-[(E)-2-(4-fluorophenyl)ethenyl]-4,6-dimethoxyphenoxy]oxan-4-yl] acetate |
| SMILES | COc1cc(/C=C/c2ccc(F)cc2)c(O[C@@H]2O[C@H]([C@@H](C)OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C31H35FO12/c1-16(39-17(2)33)26-28(40-18(3)34)29(41-19(4)35)30(42-20(5)36)31(43-26)44-27-22(14-24(37-6)15-25(27)38-7)11-8-21-9-12-23(32)13-10-21/h8-16,26,28-31H,1-7H3/b11-8+/t16-,26-,28-,29+,30-,31+/m1/s1 |
| InChIKey | WMPJIYKZCSAQQH-JTSMDUMJSA-N |
| XLogP | 3.86 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|