C11H16FN — CID 145233855
N-cyclopentyl-4-fluorocyclohexa-1,3-dien-1-amine (PubChem CID 145233855) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is N-cyclopentyl-4-fluorocyclohexa-1,3-dien-1-amine.
| Compound Name | N-cyclopentyl-4-fluorocyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145233855 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | N-cyclopentyl-4-fluorocyclohexa-1,3-dien-1-amine |
| SMILES | FC1=CC=C(NC2CCCC2)CC1 |
| InChI | InChI=1S/C11H16FN/c12-9-5-7-11(8-6-9)13-10-3-1-2-4-10/h5,7,10,13H,1-4,6,8H2 |
| InChIKey | IVQCEVVCKNSKPD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |