About 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane
1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane (PubChem CID 145234037) has the molecular formula C17H28OS
and a molecular weight of 280.48 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane.
Molecular Properties
| Compound Name | 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane |
| PubChem CID | 145234037 |
| Molecular Formula | C17H28OS |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane |
| SMILES | CC(C)c1ccc(CC2CCCC2)cc1.CCSO |
| InChI | InChI=1S/C15H22.C2H6OS/c1-12(2)15-9-7-14(8-10-15)11-13-5-3-4-6-13;1-2-4-3/h7-10,12-13H,3-6,11H2,1-2H3;3H,2H2,1H3 |
| InChIKey | UPDYJRDWJIEGFK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane?
The IUPAC name of 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane (CID 145234037) is 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane.
What is the SMILES notation for 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane?
The canonical SMILES for 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane is CC(C)c1ccc(CC2CCCC2)cc1.CCSO.
What is the InChIKey of 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane?
The InChIKey is UPDYJRDWJIEGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22.C2H6OS/c1-12(2)15-9-7-14(8-10-15)11-13-5-3-4-6-13;1-2-4-3/h7-10,12-13H,3-6,11H2,1-2H3;3H,2H2,1H3.
What are the key properties of 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane?
1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane has a molecular weight of 280.48 g/mol, XLogP of 5.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentylmethyl)-4-propan-2-ylbenzene;hydroxysulfanylethane is sourced from PubChem (CID 145234037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).