About 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile
1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile (PubChem CID 145234656) has the molecular formula C13H14ClNO
and a molecular weight of 235.71 g/mol. Its IUPAC name is 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile.
Molecular Properties
| Compound Name | 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile |
| PubChem CID | 145234656 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile |
| SMILES | CC(=O)c1cc(C)ccc1Cl.N#CC1CC1 |
| InChI | InChI=1S/C9H9ClO.C4H5N/c1-6-3-4-9(10)8(5-6)7(2)11;5-3-4-1-2-4/h3-5H,1-2H3;4H,1-2H2 |
| InChIKey | DZQBDDOSIZIXFM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile?
The IUPAC name of 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile (CID 145234656) is 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile.
What is the SMILES notation for 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile?
The canonical SMILES for 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile is CC(=O)c1cc(C)ccc1Cl.N#CC1CC1.
What is the InChIKey of 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile?
The InChIKey is DZQBDDOSIZIXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO.C4H5N/c1-6-3-4-9(10)8(5-6)7(2)11;5-3-4-1-2-4/h3-5H,1-2H3;4H,1-2H2.
What are the key properties of 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile?
1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile has a molecular weight of 235.71 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloro-5-methylphenyl)ethanone;cyclopropanecarbonitrile is sourced from PubChem (CID 145234656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).