C32H45N6O5+ — CID 145234696
1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one;ethane;hydroxy-[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]azanium (PubChem CID 145234696) has the molecular formula C32H45N6O5+ and a molecular weight of 593.75 g/mol. Its IUPAC name is 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one;ethane;hydroxy-[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]azanium.
| Compound Name | 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one;ethane;hydroxy-[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]azanium |
|---|---|
| PubChem CID | 145234696 |
| Molecular Formula | C32H45N6O5+ |
| Molecular Weight | 593.75 g/mol |
| Exact Mass | 593.34 |
| IUPAC Name | 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one;ethane;hydroxy-[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]azanium |
| SMILES | CC.Nc1ccc(N2CCC=C(N3CCOCC3)C2=O)cc1.O=C1C(N2CCOCC2)=CCCN1c1ccc([NH2+]O)cc1 |
| InChI | InChI=1S/C15H19N3O3.C15H19N3O2.C2H6/c19-15-14(17-8-10-21-11-9-17)2-1-7-18(15)13-5-3-12(16-20)4-6-13;16-12-3-5-13(6-4-12)18-7-1-2-14(15(18)19)17-8-10-20-11-9-17;1-2/h2-6,16,20H,1,7-11H2;2-6H,1,7-11,16H2;1-2H3/p+1 |
| InChIKey | LYKNYEIFQWNQFB-UHFFFAOYSA-O |
| XLogP | 2.47 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|