C18H18N6O2 — CID 169341997
2-[[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169341997) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-[[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169341997 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[[4-(5-morpholin-4-yl-6-oxo-2,3-dihydropyridin-1-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccc(N2CCC=C(N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C18H18N6O2/c19-12-15(13-20)22-21-14-3-5-16(6-4-14)24-7-1-2-17(18(24)25)23-8-10-26-11-9-23/h2-6,21H,1,7-11H2 |
| InChIKey | HMYOPRMFGYNTHS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|