C22H24N6O — CID 145236085
4-[[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-propylpyridine-3-carboxamide (PubChem CID 145236085) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-[[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-propylpyridine-3-carboxamide.
| Compound Name | 4-[[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-propylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 145236085 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-[[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]-N-propylpyridine-3-carboxamide |
| SMILES | C=C(/C=C\C=C/C)c1nc(Nc2ccncc2C(=O)NCCC)c2cccn2n1 |
| InChI | InChI=1S/C22H24N6O/c1-4-6-7-9-16(3)20-26-21(19-10-8-14-28(19)27-20)25-18-11-13-23-15-17(18)22(29)24-12-5-2/h4,6-11,13-15H,3,5,12H2,1-2H3,(H,24,29)(H,23,25,26,27)/b6-4-,9-7- |
| InChIKey | QCKUFVGRCVHXOX-PJPBHMPJSA-N |
| XLogP | 4.15 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|