C11H21I — CID 145238118
ethane;(2Z,4E)-5-(iodomethyl)-3-methylhepta-2,4-diene (PubChem CID 145238118) has the molecular formula C11H21I and a molecular weight of 280.19 g/mol. Its IUPAC name is ethane;(2Z,4E)-5-(iodomethyl)-3-methylhepta-2,4-diene.
| Compound Name | ethane;(2Z,4E)-5-(iodomethyl)-3-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 145238118 |
| Molecular Formula | C11H21I |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | ethane;(2Z,4E)-5-(iodomethyl)-3-methylhepta-2,4-diene |
| SMILES | C/C=C(C)\C=C(/CC)CI.CC |
| InChI | InChI=1S/C9H15I.C2H6/c1-4-8(3)6-9(5-2)7-10;1-2/h4,6H,5,7H2,1-3H3;1-2H3/b8-4-,9-6+; |
| InChIKey | ZPOAOYITOQAQCD-IMQWIENCSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|