C12H14F2N2O — CID 145238383
2,2-difluoroethyl (1Z)-4-ethyl-N-methylidenebenzenecarbohydrazonate (PubChem CID 145238383) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-ethyl-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-4-ethyl-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238383 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-ethyl-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CC)cc1 |
| InChI | InChI=1S/C12H14F2N2O/c1-3-9-4-6-10(7-5-9)12(16-15-2)17-8-11(13)14/h4-7,11H,2-3,8H2,1H3/b16-12- |
| InChIKey | PUZMGDXDJPODHU-VBKFSLOCSA-N |
| XLogP | 2.89 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|