C19H18F2N6OS — CID 145238487
N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-ethylsulfanyl-1-methylindazol-4-amine (PubChem CID 145238487) has the molecular formula C19H18F2N6OS and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-ethylsulfanyl-1-methylindazol-4-amine.
| Compound Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-ethylsulfanyl-1-methylindazol-4-amine |
|---|---|
| PubChem CID | 145238487 |
| Molecular Formula | C19H18F2N6OS |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-ethylsulfanyl-1-methylindazol-4-amine |
| SMILES | CCSN(Cc1ccc(-c2nnc(C(F)F)o2)cn1)c1cccc2c1cnn2C |
| InChI | InChI=1S/C19H18F2N6OS/c1-3-29-27(16-6-4-5-15-14(16)10-23-26(15)2)11-13-8-7-12(9-22-13)18-24-25-19(28-18)17(20)21/h4-10,17H,3,11H2,1-2H3 |
| InChIKey | ZBFVQWYGVBPQEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|