C18H18F4N4OS — CID 145238685
3-fluoro-4-[[methylsulfanyl(pyridin-2-ylmethyl)amino]methyl]-N'-(3,3,3-trifluoroprop-1-en-2-yl)benzohydrazide (PubChem CID 145238685) has the molecular formula C18H18F4N4OS and a molecular weight of 414.43 g/mol. Its IUPAC name is 3-fluoro-4-[[methylsulfanyl(pyridin-2-ylmethyl)amino]methyl]-N'-(3,3,3-trifluoroprop-1-en-2-yl)benzohydrazide.
| Compound Name | 3-fluoro-4-[[methylsulfanyl(pyridin-2-ylmethyl)amino]methyl]-N'-(3,3,3-trifluoroprop-1-en-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 145238685 |
| Molecular Formula | C18H18F4N4OS |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 3-fluoro-4-[[methylsulfanyl(pyridin-2-ylmethyl)amino]methyl]-N'-(3,3,3-trifluoroprop-1-en-2-yl)benzohydrazide |
| SMILES | C=C(NNC(=O)c1ccc(CN(Cc2ccccn2)SC)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C18H18F4N4OS/c1-12(18(20,21)22)24-25-17(27)13-6-7-14(16(19)9-13)10-26(28-2)11-15-5-3-4-8-23-15/h3-9,24H,1,10-11H2,2H3,(H,25,27) |
| InChIKey | UEQYUAGSOVUZFN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|