C24H30F2N4O3S — CID 145238959
2,2-difluoroethyl (1Z)-4-[[N-[2-(3-hydroxypiperidin-1-yl)ethylsulfinyl]anilino]methyl]-N-methylidenebenzenecarbohydrazonate (PubChem CID 145238959) has the molecular formula C24H30F2N4O3S and a molecular weight of 492.59 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-[[N-[2-(3-hydroxypiperidin-1-yl)ethylsulfinyl]anilino]methyl]-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-4-[[N-[2-(3-hydroxypiperidin-1-yl)ethylsulfinyl]anilino]methyl]-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238959 |
| Molecular Formula | C24H30F2N4O3S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-[[N-[2-(3-hydroxypiperidin-1-yl)ethylsulfinyl]anilino]methyl]-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(c2ccccc2)S(=O)CCN2CCCC(O)C2)cc1 |
| InChI | InChI=1S/C24H30F2N4O3S/c1-27-28-24(33-18-23(25)26)20-11-9-19(10-12-20)16-30(21-6-3-2-4-7-21)34(32)15-14-29-13-5-8-22(31)17-29/h2-4,6-7,9-12,22-23,31H,1,5,8,13-18H2/b28-24- |
| InChIKey | DNPQJJDCLGCTAW-COOPMVRXSA-N |
| XLogP | 3.46 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|