C24H30F2N4O2S — CID 145238778
2,2-difluoroethyl (1Z)-4-[(N-(1-ethylpiperidin-4-yl)sulfinylanilino)methyl]-N-methylidenebenzenecarbohydrazonate (PubChem CID 145238778) has the molecular formula C24H30F2N4O2S and a molecular weight of 476.59 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-[(N-(1-ethylpiperidin-4-yl)sulfinylanilino)methyl]-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-4-[(N-(1-ethylpiperidin-4-yl)sulfinylanilino)methyl]-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238778 |
| Molecular Formula | C24H30F2N4O2S |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-[(N-(1-ethylpiperidin-4-yl)sulfinylanilino)methyl]-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(c2ccccc2)S(=O)C2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C24H30F2N4O2S/c1-3-29-15-13-22(14-16-29)33(31)30(21-7-5-4-6-8-21)17-19-9-11-20(12-10-19)24(28-27-2)32-18-23(25)26/h4-12,22-23H,2-3,13-18H2,1H3/b28-24- |
| InChIKey | RXCKJYSQHYKKAW-COOPMVRXSA-N |
| XLogP | 4.49 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|