C20H22F2N4 — CID 145239082
N-[[4-[(E)-C-(3,3-difluoropropyl)-N-(methylideneamino)carbonimidoyl]phenyl]methyl]-N-phenylaziridin-1-amine (PubChem CID 145239082) has the molecular formula C20H22F2N4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[[4-[(E)-C-(3,3-difluoropropyl)-N-(methylideneamino)carbonimidoyl]phenyl]methyl]-N-phenylaziridin-1-amine.
| Compound Name | N-[[4-[(E)-C-(3,3-difluoropropyl)-N-(methylideneamino)carbonimidoyl]phenyl]methyl]-N-phenylaziridin-1-amine |
|---|---|
| PubChem CID | 145239082 |
| Molecular Formula | C20H22F2N4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[[4-[(E)-C-(3,3-difluoropropyl)-N-(methylideneamino)carbonimidoyl]phenyl]methyl]-N-phenylaziridin-1-amine |
| SMILES | C=N/N=C(\CCC(F)F)c1ccc(CN(c2ccccc2)N2CC2)cc1 |
| InChI | InChI=1S/C20H22F2N4/c1-23-24-19(11-12-20(21)22)17-9-7-16(8-10-17)15-26(25-13-14-25)18-5-3-2-4-6-18/h2-10,20H,1,11-15H2/b24-19+ |
| InChIKey | BLDVQGHJFPOYQQ-LYBHJNIJSA-N |
| XLogP | 4.37 |
| TPSA | 30.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|