C25H32F2N4O2S — CID 145238410
2,2-difluoroethyl (1Z)-N-methylidene-4-[[N-[2-(4-methylpiperidin-1-yl)ethylsulfinyl]anilino]methyl]benzenecarbohydrazonate (PubChem CID 145238410) has the molecular formula C25H32F2N4O2S and a molecular weight of 490.62 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-N-methylidene-4-[[N-[2-(4-methylpiperidin-1-yl)ethylsulfinyl]anilino]methyl]benzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-N-methylidene-4-[[N-[2-(4-methylpiperidin-1-yl)ethylsulfinyl]anilino]methyl]benzenecarbohydrazonate |
|---|---|
| PubChem CID | 145238410 |
| Molecular Formula | C25H32F2N4O2S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-N-methylidene-4-[[N-[2-(4-methylpiperidin-1-yl)ethylsulfinyl]anilino]methyl]benzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(c2ccccc2)S(=O)CCN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C25H32F2N4O2S/c1-20-12-14-30(15-13-20)16-17-34(32)31(23-6-4-3-5-7-23)18-21-8-10-22(11-9-21)25(29-28-2)33-19-24(26)27/h3-11,20,24H,2,12-19H2,1H3/b29-25- |
| InChIKey | DVTAHIXPAIVOQE-GNVQSUKOSA-N |
| XLogP | 4.73 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|