C19H27F2N3O2 — CID 145239296
2,2-difluoroethyl (1Z)-4-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]-N-methylidenebenzenecarbohydrazonate (PubChem CID 145239296) has the molecular formula C19H27F2N3O2 and a molecular weight of 367.44 g/mol. Its IUPAC name is 2,2-difluoroethyl (1Z)-4-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]-N-methylidenebenzenecarbohydrazonate.
| Compound Name | 2,2-difluoroethyl (1Z)-4-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]-N-methylidenebenzenecarbohydrazonate |
|---|---|
| PubChem CID | 145239296 |
| Molecular Formula | C19H27F2N3O2 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2,2-difluoroethyl (1Z)-4-[3-[3-(hydroxymethyl)piperidin-1-yl]propyl]-N-methylidenebenzenecarbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CCCN2CCCC(CO)C2)cc1 |
| InChI | InChI=1S/C19H27F2N3O2/c1-22-23-19(26-14-18(20)21)17-8-6-15(7-9-17)4-2-10-24-11-3-5-16(12-24)13-25/h6-9,16,18,25H,1-5,10-14H2/b23-19- |
| InChIKey | DBKSDUGBRVHDJD-NMWGTECJSA-N |
| XLogP | 2.97 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|