C22H37N — CID 145242370
butane;2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine (PubChem CID 145242370) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is butane;2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine.
| Compound Name | butane;2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine |
|---|---|
| PubChem CID | 145242370 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | butane;2,4-dimethyl-7-[(3Z)-4,6,6-trimethylhepta-1,3-dien-3-yl]-2H-azepine |
| SMILES | C=C/C(C1=NC(C)C=C(C)C=C1)=C(\C)CC(C)(C)C.CCCC |
| InChI | InChI=1S/C18H27N.C4H10/c1-8-16(14(3)12-18(5,6)7)17-10-9-13(2)11-15(4)19-17;1-3-4-2/h8-11,15H,1,12H2,2-7H3;3-4H2,1-2H3/b16-14-; |
| InChIKey | GBVIWJOBDCOFCP-ULQCMBKMSA-N |
| XLogP | 7.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|