C58H56N2 — CID 145243418
1,1-dimethyl-9-(4-methylphenyl)-2-phenyl-5,6-dihydropyrrolo[3,2-b]carbazole;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;2,9,9-trimethylfluorene (PubChem CID 145243418) has the molecular formula C58H56N2 and a molecular weight of 781.10 g/mol. Its IUPAC name is 1,1-dimethyl-9-(4-methylphenyl)-2-phenyl-5,6-dihydropyrrolo[3,2-b]carbazole;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;2,9,9-trimethylfluorene.
| Compound Name | 1,1-dimethyl-9-(4-methylphenyl)-2-phenyl-5,6-dihydropyrrolo[3,2-b]carbazole;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;2,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 145243418 |
| Molecular Formula | C58H56N2 |
| Molecular Weight | 781.10 g/mol |
| Exact Mass | 780.44 |
| IUPAC Name | 1,1-dimethyl-9-(4-methylphenyl)-2-phenyl-5,6-dihydropyrrolo[3,2-b]carbazole;1-[(3E)-hexa-1,3,5-trien-3-yl]-4-methylbenzene;2,9,9-trimethylfluorene |
| SMILES | C=C/C=C(\C=C)c1ccc(C)cc1.Cc1ccc(-n2c3c(c4cc5c(cc42)C(C)(C)C(c2ccccc2)=N5)CCC=C3)cc1.Cc1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C29H26N2.C16H16.C13H14/c1-19-13-15-21(16-14-19)31-26-12-8-7-11-22(26)23-17-25-24(18-27(23)31)29(2,3)28(30-25)20-9-5-4-6-10-20;1-11-8-9-13-12-6-4-5-7-14(12)16(2,3)15(13)10-11;1-4-6-12(5-2)13-9-7-11(3)8-10-13/h4-6,8-10,12-18H,7,11H2,1-3H3;4-10H,1-3H3;4-10H,1-2H2,3H3/b;;12-6+ |
| InChIKey | XSJGKHDNNHEUGY-WPGPNXFZSA-N |
| XLogP | 15.36 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.10 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|