C16H18O6 — CID 14524778
methyl (2Z)-2-[(4Z)-4-(5-butyl-5-methylfuran-2-ylidene)-3,5-dioxooxolan-2-ylidene]acetate (PubChem CID 14524778) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is methyl (2Z)-2-[(4Z)-4-(5-butyl-5-methylfuran-2-ylidene)-3,5-dioxooxolan-2-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[(4Z)-4-(5-butyl-5-methylfuran-2-ylidene)-3,5-dioxooxolan-2-ylidene]acetate |
|---|---|
| PubChem CID | 14524778 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | methyl (2Z)-2-[(4Z)-4-(5-butyl-5-methylfuran-2-ylidene)-3,5-dioxooxolan-2-ylidene]acetate |
| SMILES | CCCCC1(C)C=C/C(=C2/C(=O)O/C(=C\C(=O)OC)C2=O)O1 |
| InChI | InChI=1S/C16H18O6/c1-4-5-7-16(2)8-6-10(22-16)13-14(18)11(21-15(13)19)9-12(17)20-3/h6,8-9H,4-5,7H2,1-3H3/b11-9-,13-10- |
| InChIKey | JXPYUBCGMFPIBF-VYXXYXFFSA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|