C15H9BrF3IN2OS — CID 145253634
[5-bromo-2-[hydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]indol-1-yl] thiohypoiodite (PubChem CID 145253634) has the molecular formula C15H9BrF3IN2OS and a molecular weight of 529.12 g/mol. Its IUPAC name is [5-bromo-2-[hydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]indol-1-yl] thiohypoiodite.
| Compound Name | [5-bromo-2-[hydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]indol-1-yl] thiohypoiodite |
|---|---|
| PubChem CID | 145253634 |
| Molecular Formula | C15H9BrF3IN2OS |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 527.86 |
| IUPAC Name | [5-bromo-2-[hydroxy-[5-(trifluoromethyl)-2-pyridinyl]methyl]indol-1-yl] thiohypoiodite |
| SMILES | OC(c1ccc(C(F)(F)F)cn1)c1cc2cc(Br)ccc2n1SI |
| InChI | InChI=1S/C15H9BrF3IN2OS/c16-10-2-4-12-8(5-10)6-13(22(12)24-20)14(23)11-3-1-9(7-21-11)15(17,18)19/h1-7,14,23H |
| InChIKey | GYKQVHUYBMZUMP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|