C19H18ClF3N4S2 — CID 145255499
[(3S)-2-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-3-methylcyclopropyl] N-fluorosulfanyl-N,N'-dimethylcarbamimidothioate (PubChem CID 145255499) has the molecular formula C19H18ClF3N4S2 and a molecular weight of 458.96 g/mol. Its IUPAC name is [(3S)-2-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-3-methylcyclopropyl] N-fluorosulfanyl-N,N'-dimethylcarbamimidothioate.
| Compound Name | [(3S)-2-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-3-methylcyclopropyl] N-fluorosulfanyl-N,N'-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 145255499 |
| Molecular Formula | C19H18ClF3N4S2 |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | [(3S)-2-[5-[(Z)-2-(5-chloropyrazin-2-yl)-2-fluoroethenyl]-2-fluorophenyl]-3-methylcyclopropyl] N-fluorosulfanyl-N,N'-dimethylcarbamimidothioate |
| SMILES | C/N=C(/SC1C(c2cc(/C=C(\F)c3cnc(Cl)cn3)ccc2F)[C@@H]1C)N(C)SF |
| InChI | InChI=1S/C19H18ClF3N4S2/c1-10-17(18(10)28-19(24-2)27(3)29-23)12-6-11(4-5-13(12)21)7-14(22)15-8-26-16(20)9-25-15/h4-10,17-18H,1-3H3/b14-7-,24-19+/t10-,17?,18?/m0/s1 |
| InChIKey | NBRWPTCRZXMGFO-WWXYOGAHSA-N |
| XLogP | 6.02 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|