C12H19N3OS — CID 145256402
N-piperidin-3-yl-5-propan-2-yl-1,2-thiazole-3-carboxamide (PubChem CID 145256402) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is N-piperidin-3-yl-5-propan-2-yl-1,2-thiazole-3-carboxamide.
| Compound Name | N-piperidin-3-yl-5-propan-2-yl-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 145256402 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-piperidin-3-yl-5-propan-2-yl-1,2-thiazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NC2CCCNC2)ns1 |
| InChI | InChI=1S/C12H19N3OS/c1-8(2)11-6-10(15-17-11)12(16)14-9-4-3-5-13-7-9/h6,8-9,13H,3-5,7H2,1-2H3,(H,14,16) |
| InChIKey | ZLYSLKDTNZEJJY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |