About triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane
triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane (PubChem CID 145256669) has the molecular formula C10H9I3N2S
and a molecular weight of 569.98 g/mol. Its IUPAC name is triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane.
Molecular Properties
| Compound Name | triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane |
| PubChem CID | 145256669 |
| Molecular Formula | C10H9I3N2S |
| Molecular Weight | 569.98 g/mol |
| Exact Mass | 569.76 |
| IUPAC Name | triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane |
| SMILES | Cc1ccc2n[nH]c(/C=C/S(I)(I)I)c2c1 |
| InChI | InChI=1S/C10H9I3N2S/c1-7-2-3-9-8(6-7)10(15-14-9)4-5-16(11,12)13/h2-6H,1H3,(H,14,15)/b5-4+ |
| InChIKey | GGAFZMWNXMVSAS-SNAWJCMRSA-N |
| XLogP | 5.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.98 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane?
The IUPAC name of triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane (CID 145256669) is triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane.
What is the SMILES notation for triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane?
The canonical SMILES for triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane is Cc1ccc2n[nH]c(/C=C/S(I)(I)I)c2c1.
What is the InChIKey of triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane?
The InChIKey is GGAFZMWNXMVSAS-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H9I3N2S/c1-7-2-3-9-8(6-7)10(15-14-9)4-5-16(11,12)13/h2-6H,1H3,(H,14,15)/b5-4+.
What are the key properties of triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane?
triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane has a molecular weight of 569.98 g/mol, XLogP of 5.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triiodo-[(E)-2-(5-methyl-2H-indazol-3-yl)ethenyl]-λ4-sulfane is sourced from PubChem (CID 145256669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).