About 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde
10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde (PubChem CID 86172567) has the molecular formula C17H13BrO
and a molecular weight of 313.19 g/mol. Its IUPAC name is 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde.
Molecular Properties
| Compound Name | 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde |
| PubChem CID | 86172567 |
| Molecular Formula | C17H13BrO |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde |
| SMILES | Cc1ccc2c(Br)c(C=O)c3ccc(C)cc3c2c1 |
| InChI | InChI=1S/C17H13BrO/c1-10-3-5-12-14(7-10)15-8-11(2)4-6-13(15)17(18)16(12)9-19/h3-9H,1-2H3 |
| InChIKey | WKPCYYQBVFROKC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde?
The IUPAC name of 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde (CID 86172567) is 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde.
What is the SMILES notation for 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde?
The canonical SMILES for 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde is Cc1ccc2c(Br)c(C=O)c3ccc(C)cc3c2c1.
What is the InChIKey of 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde?
The InChIKey is WKPCYYQBVFROKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrO/c1-10-3-5-12-14(7-10)15-8-11(2)4-6-13(15)17(18)16(12)9-19/h3-9H,1-2H3.
What are the key properties of 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde?
10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde has a molecular weight of 313.19 g/mol, XLogP of 5.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-bromo-3,6-dimethylphenanthrene-9-carbaldehyde is sourced from PubChem (CID 86172567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).