C10H16N2 — CID 145259418
N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine (PubChem CID 145259418) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine.
| Compound Name | N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine |
|---|---|
| PubChem CID | 145259418 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine |
| SMILES | CC/N=C(\C)C1=C(C)CCC=N1 |
| InChI | InChI=1S/C10H16N2/c1-4-11-9(3)10-8(2)6-5-7-12-10/h7H,4-6H2,1-3H3/b11-9+ |
| InChIKey | SGQCKZVWTKLYQT-PKNBQFBNSA-N |
| XLogP | 2.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|