C14H27N2+ — CID 91207346
3-(C,N-dimethylcarbonimidoyl)oct-2-en-2-yl-ethylidene-methylazanium (PubChem CID 91207346) has the molecular formula C14H27N2+ and a molecular weight of 223.38 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)oct-2-en-2-yl-ethylidene-methylazanium.
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)oct-2-en-2-yl-ethylidene-methylazanium |
|---|---|
| PubChem CID | 91207346 |
| Molecular Formula | C14H27N2+ |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.22 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)oct-2-en-2-yl-ethylidene-methylazanium |
| SMILES | C/C=[N+](\C)C(C)=C(CCCCC)/C(C)=N/C |
| InChI | InChI=1S/C14H27N2/c1-7-9-10-11-14(12(3)15-5)13(4)16(6)8-2/h8H,7,9-11H2,1-6H3/q+1/b14-13?,15-12+,16-8+ |
| InChIKey | RJYOYHDATDZHLH-LVASLQBMSA-N |
| XLogP | 3.66 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|