C9H15N5O2 — CID 145259461
N-[4-amino-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-2-methylpropanamide (PubChem CID 145259461) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-[4-amino-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-2-methylpropanamide.
| Compound Name | N-[4-amino-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 145259461 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | N-[4-amino-5-(methylamino)-6-oxo-1H-pyrimidin-2-yl]-2-methylpropanamide |
| SMILES | CNc1c(N)nc(NC(=O)C(C)C)[nH]c1=O |
| InChI | InChI=1S/C9H15N5O2/c1-4(2)7(15)13-9-12-6(10)5(11-3)8(16)14-9/h4,11H,1-3H3,(H4,10,12,13,14,15,16) |
| InChIKey | NWPHPPANCHZEOX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |