C37H37N3O — CID 145261332
[(Z)-1,3-diphenylprop-1-enyl]hydrazine;6-methyl-2-[(1Z)-3-phenylmethoxybuta-1,3-dienyl]naphthalen-1-amine (PubChem CID 145261332) has the molecular formula C37H37N3O and a molecular weight of 539.72 g/mol. Its IUPAC name is [(Z)-1,3-diphenylprop-1-enyl]hydrazine;6-methyl-2-[(1Z)-3-phenylmethoxybuta-1,3-dienyl]naphthalen-1-amine.
| Compound Name | [(Z)-1,3-diphenylprop-1-enyl]hydrazine;6-methyl-2-[(1Z)-3-phenylmethoxybuta-1,3-dienyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 145261332 |
| Molecular Formula | C37H37N3O |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | [(Z)-1,3-diphenylprop-1-enyl]hydrazine;6-methyl-2-[(1Z)-3-phenylmethoxybuta-1,3-dienyl]naphthalen-1-amine |
| SMILES | C=C(/C=C\c1ccc2cc(C)ccc2c1N)OCc1ccccc1.NN/C(=C\Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21NO.C15H16N2/c1-16-8-13-21-20(14-16)12-11-19(22(21)23)10-9-17(2)24-15-18-6-4-3-5-7-18;16-17-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h3-14H,2,15,23H2,1H3;1-10,12,17H,11,16H2/b10-9-;15-12- |
| InChIKey | ZQOWBPXCZMCSOW-XMESOHQFSA-N |
| XLogP | 8.21 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|