C11H14N2O — CID 145262835
6,6-dimethyl-5-phenyl-2,5-dihydro-1,2,4-oxadiazine (PubChem CID 145262835) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 6,6-dimethyl-5-phenyl-2,5-dihydro-1,2,4-oxadiazine.
| Compound Name | 6,6-dimethyl-5-phenyl-2,5-dihydro-1,2,4-oxadiazine |
|---|---|
| PubChem CID | 145262835 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 6,6-dimethyl-5-phenyl-2,5-dihydro-1,2,4-oxadiazine |
| SMILES | CC1(C)ONC=NC1c1ccccc1 |
| InChI | InChI=1S/C11H14N2O/c1-11(2)10(12-8-13-14-11)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13) |
| InChIKey | IPNGHEDTXJWFPU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |