C12H15BrN2O — CID 145265617
6-amino-8-bromo-1-propyl-3,4-dihydroquinolin-2-one (PubChem CID 145265617) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 6-amino-8-bromo-1-propyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-8-bromo-1-propyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 145265617 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 6-amino-8-bromo-1-propyl-3,4-dihydroquinolin-2-one |
| SMILES | CCCN1C(=O)CCc2cc(N)cc(Br)c21 |
| InChI | InChI=1S/C12H15BrN2O/c1-2-5-15-11(16)4-3-8-6-9(14)7-10(13)12(8)15/h6-7H,2-5,14H2,1H3 |
| InChIKey | CJTFDHUKRDTLAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|