C16H15FN2O — CID 170748582
6-amino-1-benzyl-8-fluoro-3,4-dihydroquinolin-2-one (PubChem CID 170748582) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is 6-amino-1-benzyl-8-fluoro-3,4-dihydroquinolin-2-one.
| Compound Name | 6-amino-1-benzyl-8-fluoro-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 170748582 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 6-amino-1-benzyl-8-fluoro-3,4-dihydroquinolin-2-one |
| SMILES | Nc1cc(F)c2c(c1)CCC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C16H15FN2O/c17-14-9-13(18)8-12-6-7-15(20)19(16(12)14)10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10,18H2 |
| InChIKey | RMBMMBDYEGLWLC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|