C14H24 — CID 145265652
(4E)-2,3,5-trimethyl-4-prop-1-en-2-ylocta-2,4-diene (PubChem CID 145265652) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (4E)-2,3,5-trimethyl-4-prop-1-en-2-ylocta-2,4-diene.
| Compound Name | (4E)-2,3,5-trimethyl-4-prop-1-en-2-ylocta-2,4-diene |
|---|---|
| PubChem CID | 145265652 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (4E)-2,3,5-trimethyl-4-prop-1-en-2-ylocta-2,4-diene |
| SMILES | C=C(C)/C(C(C)=C(C)C)=C(/C)CCC |
| InChI | InChI=1S/C14H24/c1-8-9-12(6)14(11(4)5)13(7)10(2)3/h4,8-9H2,1-3,5-7H3/b14-12+ |
| InChIKey | KYQFSDUOIKGIPA-WYMLVPIESA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|