C12H10ClF — CID 145265931
1-[(3Z)-2-chlorohexa-1,3,5-trien-3-yl]-2-fluorobenzene (PubChem CID 145265931) has the molecular formula C12H10ClF and a molecular weight of 208.66 g/mol. Its IUPAC name is 1-[(3Z)-2-chlorohexa-1,3,5-trien-3-yl]-2-fluorobenzene.
| Compound Name | 1-[(3Z)-2-chlorohexa-1,3,5-trien-3-yl]-2-fluorobenzene |
|---|---|
| PubChem CID | 145265931 |
| Molecular Formula | C12H10ClF |
| Molecular Weight | 208.66 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-[(3Z)-2-chlorohexa-1,3,5-trien-3-yl]-2-fluorobenzene |
| SMILES | C=C/C=C(\C(=C)Cl)c1ccccc1F |
| InChI | InChI=1S/C12H10ClF/c1-3-6-10(9(2)13)11-7-4-5-8-12(11)14/h3-8H,1-2H2/b10-6+ |
| InChIKey | PHEOFDYFHREBHP-UXBLZVDNSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|