C14H13FOS — CID 143781864
1-(2-fluorophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanone (PubChem CID 143781864) has the molecular formula C14H13FOS and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanone.
| Compound Name | 1-(2-fluorophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 143781864 |
| Molecular Formula | C14H13FOS |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-(2-fluorophenyl)-2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethanone |
| SMILES | C=C/C=C(\C=C)SCC(=O)c1ccccc1F |
| InChI | InChI=1S/C14H13FOS/c1-3-7-11(4-2)17-10-14(16)12-8-5-6-9-13(12)15/h3-9H,1-2,10H2/b11-7+ |
| InChIKey | WQKVGWLYKGWHAJ-YRNVUSSQSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|