[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid

C16H21BO2 — CID 145266644

IUPAC[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid
SMILESC=C(/C=C\C(=C/C(C)CC)c1ccccc1)B(O)O
InChIInChI=1S/C16H21BO2/c1-4-13(2)12-16(11-10-14(3)17(18)19)15-8-6-5-7-9-15/h5-13,18-19H,3-4H2,1-2H3/b11-10-,16-12+
InChIKeyODSJHNVMFQMPSS-JNCCTMNUSA-N
MW256.15 g/mol
LogP3.24
Rot. Bonds6

About [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid

[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid (PubChem CID 145266644) has the molecular formula C16H21BO2 and a molecular weight of 256.15 g/mol. Its IUPAC name is [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid.

Molecular Properties

Compound Name[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid
PubChem CID145266644
Molecular FormulaC16H21BO2
Molecular Weight256.15 g/mol
Exact Mass256.16
IUPAC Name[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid
SMILESC=C(/C=C\C(=C/C(C)CC)c1ccccc1)B(O)O
InChIInChI=1S/C16H21BO2/c1-4-13(2)12-16(11-10-14(3)17(18)19)15-8-6-5-7-9-15/h5-13,18-19H,3-4H2,1-2H3/b11-10-,16-12+
InChIKeyODSJHNVMFQMPSS-JNCCTMNUSA-N
XLogP3.24
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.15
LogP ≤ 53.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid?
The IUPAC name of [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid (CID 145266644) is [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid.
What is the SMILES notation for [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid?
The canonical SMILES for [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid is C=C(/C=C\C(=C/C(C)CC)c1ccccc1)B(O)O.
What is the InChIKey of [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid?
The InChIKey is ODSJHNVMFQMPSS-JNCCTMNUSA-N. The full InChI is InChI=1S/C16H21BO2/c1-4-13(2)12-16(11-10-14(3)17(18)19)15-8-6-5-7-9-15/h5-13,18-19H,3-4H2,1-2H3/b11-10-,16-12+.
What are the key properties of [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid?
[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid has a molecular weight of 256.15 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid is sourced from PubChem (CID 145266644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).