C16H21BO2 — CID 145266644
[(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid (PubChem CID 145266644) has the molecular formula C16H21BO2 and a molecular weight of 256.15 g/mol. Its IUPAC name is [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid.
| Compound Name | [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid |
|---|---|
| PubChem CID | 145266644 |
| Molecular Formula | C16H21BO2 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | [(3Z,5E)-7-methyl-5-phenylnona-1,3,5-trien-2-yl]boronic acid |
| SMILES | C=C(/C=C\C(=C/C(C)CC)c1ccccc1)B(O)O |
| InChI | InChI=1S/C16H21BO2/c1-4-13(2)12-16(11-10-14(3)17(18)19)15-8-6-5-7-9-15/h5-13,18-19H,3-4H2,1-2H3/b11-10-,16-12+ |
| InChIKey | ODSJHNVMFQMPSS-JNCCTMNUSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|