C21H29NO — CID 170091577
(E)-4,5,5-trimethyl-2-[(1Z)-3-(methylamino)buta-1,3-dienyl]-1-phenylhept-2-en-1-one (PubChem CID 170091577) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is (E)-4,5,5-trimethyl-2-[(1Z)-3-(methylamino)buta-1,3-dienyl]-1-phenylhept-2-en-1-one.
| Compound Name | (E)-4,5,5-trimethyl-2-[(1Z)-3-(methylamino)buta-1,3-dienyl]-1-phenylhept-2-en-1-one |
|---|---|
| PubChem CID | 170091577 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | (E)-4,5,5-trimethyl-2-[(1Z)-3-(methylamino)buta-1,3-dienyl]-1-phenylhept-2-en-1-one |
| SMILES | C=C(/C=C\C(=C/C(C)C(C)(C)CC)C(=O)c1ccccc1)NC |
| InChI | InChI=1S/C21H29NO/c1-7-21(4,5)16(2)15-19(14-13-17(3)22-6)20(23)18-11-9-8-10-12-18/h8-16,22H,3,7H2,1-2,4-6H3/b14-13-,19-15+ |
| InChIKey | JYGIZMLTHLSJEY-GCYSJDCNSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|