C17H20FN3O3 — CID 145267435
N-fluoromethanamine;5-formyl-N-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide (PubChem CID 145267435) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-fluoromethanamine;5-formyl-N-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide.
| Compound Name | N-fluoromethanamine;5-formyl-N-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 145267435 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-fluoromethanamine;5-formyl-N-methyl-1-[(3-methylphenyl)methyl]-2-oxopyridine-3-carboxamide |
| SMILES | CNC(=O)c1cc(C=O)cn(Cc2cccc(C)c2)c1=O.CNF |
| InChI | InChI=1S/C16H16N2O3.CH4FN/c1-11-4-3-5-12(6-11)8-18-9-13(10-19)7-14(16(18)21)15(20)17-2;1-3-2/h3-7,9-10H,8H2,1-2H3,(H,17,20);3H,1H3 |
| InChIKey | RQYYYDJDWDDJNE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|